Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6,8-Dimethyl-1H-Imidazo[4,5-h]Quinoline |
|---|---|
| Molecular Structure | ![CAS#: 137654-49-0， 6,8-Dimethyl-1H-Imidazo[4,5-h]Quinoline](/moreStructures/137654-49-0.gif) |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 137654-49-0 |
| SMILES | CC1=CC(=NC2=C1C=CC3=C2NC=N3)C |
| InChI | 1S/C12H11N3/c1-7-5-8(2)15-11-9(7)3-4-10-12(11)14-6-13-10/h3-6H,1-2H3,(H,13,14) |
| InChIKey | MAASEXRSDLAVOC-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.9±40.0°C at 760 mmHg (Cal.) |
| Flash point | 232.2±20.3°C (Cal.) |
| Refractive index | 1.735 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dimethyl-1H-Imidazo[4,5-h]Quinoline |