Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,5-Dimethyl-1H-Imidazo[4,5-f]Quinoline |
|---|---|
| Synonyms | 1,5-dimethyl-1H-imidazo[4,5-f]quinoline |
| Molecular Structure | ![CAS#: 147057-23-6， 1,5-Dimethyl-1H-Imidazo[4,5-f]Quinoline](/moreStructures/147057-23-6.gif) |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 147057-23-6 |
| SMILES | Cc1cc2c(c3c1nccc3)n(cn2)C |
| InChI | 1S/C12H11N3/c1-8-6-10-12(15(2)7-14-10)9-4-3-5-13-11(8)9/h3-7H,1-2H3 |
| InChIKey | UXQZFFUWQKNZBJ-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.086°C at 760 mmHg (Cal.) |
| Flash point | 194.555°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethyl-1H-Imidazo[4,5-f]Quinoline |