Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(4-Isobutylbenzyl)Acrylic Acid |
|---|---|
| Synonyms | 2-(4-isobutylbenzyl)acrylic acid |
| Molecular Structure |  |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 139477-93-3 |
| SMILES | CC(C)Cc1ccc(cc1)CC(=C)C(=O)O |
| InChI | 1S/C14H18O2/c1-10(2)8-12-4-6-13(7-5-12)9-11(3)14(15)16/h4-7,10H,3,8-9H2,1-2H3,(H,15,16) |
| InChIKey | MFXULEJIVCESPU-UHFFFAOYSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.998°C at 760 mmHg (Cal.) |
| Flash point | 270.142°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Isobutylbenzyl)Acrylic Acid |