Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Isobutylbenzoxazole |
|---|---|
| Synonyms | 2-Isobutyl-1,3-Benzoxazole; 2-Isobutylbenzoxazole |
| Molecular Structure |  |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 |
| CAS Registry Number | 6797-50-8 |
| EINECS | 229-870-1 |
| SMILES | C1=CC=CC2=C1N=C(CC(C)C)O2 |
| InChI | 1S/C11H13NO/c1-8(2)7-11-12-9-5-3-4-6-10(9)13-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | ZORIKMFUXMCILS-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.225°C at 760 mmHg (Cal.) |
| Flash point | 95.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isobutylbenzoxazole |