Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(2-Chloroethyl)-3-(2,5-Dichlorophenyl)Urea |
|---|---|
| Synonyms | Urea, 1-(2-chloroethyl)-3-(2,5-dichlorophenyl)-; BRN 2851069; NSC 80348 |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl3N2O |
| Molecular Weight | 267.54 |
| CAS Registry Number | 14036-56-7 |
| SMILES | Clc1ccc(Cl)cc1NC(=O)NCCCl |
| InChI | 1S/C9H9Cl3N2O/c10-3-4-13-9(15)14-8-5-6(11)1-2-7(8)12/h1-2,5H,3-4H2,(H2,13,14,15) |
| InChIKey | MXJGICZYDBJGGY-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.234°C at 760 mmHg (Cal.) |
| Flash point | 162.592°C (Cal.) |
| Refractive index | 1.609 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloroethyl)-3-(2,5-Dichlorophenyl)Urea |