Online Database of Chemicals from Around the World
|
CAS#: 141420-50-0 Product: 2-[(4-{[4-(Benzyloxy)Phenyl]Sulfonyl}Phenoxy)Methyl]-2-Methyloxirane No suppilers available for the product. |
| Name | 2-[(4-{[4-(Benzyloxy)Phenyl]Sulfonyl}Phenoxy)Methyl]-2-Methyloxirane |
|---|---|
| Molecular Structure | ![CAS#: 141420-50-0， 2-[(4-{[4-(Benzyloxy)Phenyl]Sulfonyl}Phenoxy)Methyl]-2-Methyloxirane](/moreStructures/141420-50-0.gif) |
| Molecular Formula | C23H22O5S |
| Molecular Weight | 410.48 |
| CAS Registry Number | 141420-50-0 |
| SMILES | O=S(=O)(c2ccc(OCc1ccccc1)cc2)c4ccc(OCC3(OC3)C)cc4 |
| InChI | 1S/C23H22O5S/c1-23(17-28-23)16-27-20-9-13-22(14-10-20)29(24,25)21-11-7-19(8-12-21)26-15-18-5-3-2-4-6-18/h2-14H,15-17H2,1H3 |
| InChIKey | UIZMKKCVKQEXMO-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.566°C at 760 mmHg (Cal.) |
| Flash point | 310.359°C (Cal.) |
| Refractive index | 1.6 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-{[4-(Benzyloxy)Phenyl]Sulfonyl}Phenoxy)Methyl]-2-Methyloxirane |