| Acesys Pharmatech | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 5-[3-(Benzyloxy)Phenyl]-1H-Pyrrolo[2,3-d]Pyrimidin-4-Amine |
|---|---|
| Synonyms | 5-(3-(benzyloxy)phenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-amine; 5-(3-(benzyloxy)phenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine; 5-[3-(benzyloxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 |
| CAS Registry Number | 475489-37-3 |
| SMILES | Nc1ncnc2ncc(c12)c4cccc(OCc3ccccc3)c4 |
| InChI | 1S/C19H16N4O/c20-18-17-16(10-21-19(17)23-12-22-18)14-7-4-8-15(9-14)24-11-13-5-2-1-3-6-13/h1-10,12H,11H2,(H3,20,21,22,23) |
| InChIKey | ZQRJZBYXLDCLFV-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 594.578°C at 760 mmHg (Cal.) |
| Flash point | 313.39°C (Cal.) |
| Refractive index | 1.716 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[3-(Benzyloxy)Phenyl]-1H-Pyrrolo[2,3-d]Pyrimidin-4-Amine |