Online Database of Chemicals from Around the World
|
CAS#: 141942-59-8 Product: 2,2-Dichloro-1,1,4-Butanetriyl Triacetate No suppilers available for the product. |
| Name | 2,2-Dichloro-1,1,4-Butanetriyl Triacetate |
|---|---|
| Synonyms | 1,1,4-Triacetoxy-2,2-dichlorobutane; ZINC02512194 |
| Molecular Structure |  |
| Molecular Formula | C10H14Cl2O6 |
| Molecular Weight | 301.12 |
| CAS Registry Number | 141942-59-8 |
| SMILES | O=C(OC(OC(=O)C)C(Cl)(Cl)CCOC(=O)C)C |
| InChI | 1S/C10H14Cl2O6/c1-6(13)16-5-4-10(11,12)9(17-7(2)14)18-8(3)15/h9H,4-5H2,1-3H3 |
| InChIKey | PRCAGFHSFZDMCU-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.178°C at 760 mmHg (Cal.) |
| Flash point | 150.875°C (Cal.) |
| Refractive index | 1.469 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-1,1,4-Butanetriyl Triacetate |