|
CAS#: 2419-73-0 Product: (2S,3R)-1,4-Dichlorobutane-2,3-Diol No suppilers available for the product. |
| Name | (2S,3R)-1,4-Dichlorobutane-2,3-Diol |
|---|---|
| Synonyms | Zinc05132004; Zinc05131813 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8Cl2O2 |
| Molecular Weight | 159.01 |
| CAS Registry Number | 2419-73-0 |
| EINECS | 219-338-7 |
| SMILES | [C@H](CCl)(O)[C@@H](O)CCl |
| InChI | 1S/C4H8Cl2O2/c5-1-3(7)4(8)2-6/h3-4,7-8H,1-2H2/t3-,4+ |
| InChIKey | SAUBRJOIKMVSRU-ZXZARUISSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.78°C at 760 mmHg (Cal.) |
| Flash point | 152.036°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S,3R)-1,4-Dichlorobutane-2,3-Diol |