Online Database of Chemicals from Around the World
|
CAS#: 1421-85-8 Product: Dibenzanthracine5,6-Oxide No suppilers available for the product. |
| Name | Dibenzanthracine5,6-Oxide |
|---|---|
| Synonyms | Dibenz(A,H)Anthracene-5,6-Oxide; 5,6-Epoxy-5,6-Dihydrodibenz(A,H)Anthracene; 5-17-02-00551 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C22H14O |
| Molecular Weight | 294.35 |
| CAS Registry Number | 1421-85-8 |
| SMILES | C1=C6C(=CC3=C1C2=C(C=CC=C2)C4OC34)C5=C(C=CC=C5)C=C6 |
| InChI | 1S/C22H14O/c1-2-6-15-13(5-1)9-10-14-11-19-16-7-3-4-8-17(16)21-22(23-21)20(19)12-18(14)15/h1-12,21-22H |
| InChIKey | XMMYSZBPSFQXDL-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.621°C at 760 mmHg (Cal.) |
| Flash point | 256.843°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzanthracine5,6-Oxide |