Online Database of Chemicals from Around the World
|
CAS#: 142817-71-8 Product: 2,4,6-Tris(1-Chloroethyl)-1,3,5-Trioxane No suppilers available for the product. |
| Name | 2,4,6-Tris(1-Chloroethyl)-1,3,5-Trioxane |
|---|---|
| Synonyms | 1,3,5-Trioxane, 2,4,6-tris(1-chloroethyl)-; 2,4,6-Tris(1-chlorethyl)-1,3,5-trioxan; 2,4,6-Tris(1-chloroethyl)-1,3,5-trioxane |
| Molecular Structure |  |
| Molecular Formula | C9H15Cl3O3 |
| Molecular Weight | 277.57 |
| CAS Registry Number | 142817-71-8 |
| SMILES | CC(C1OC(OC(O1)C(C)Cl)C(C)Cl)Cl |
| InChI | 1S/C9H15Cl3O3/c1-4(10)7-13-8(5(2)11)15-9(14-7)6(3)12/h4-9H,1-3H3 |
| InChIKey | XTQUGQZRFTWKFM-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.5±37.0°C at 760 mmHg (Cal.) |
| Flash point | 116.9±26.6°C (Cal.) |
| Refractive index | 1.464 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Tris(1-Chloroethyl)-1,3,5-Trioxane |