| Beijing Mesochem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.mesochem.com | |||
![]() | +86 (10) 5786-2036 57862181 67374028 +86 13366977697 | |||
![]() | +86 (10) 5786-2181 | |||
![]() | sales@mesochem.com huafenginfo@126.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Advint Pharmaceutical Pvt Ltd. | India | |||
|---|---|---|---|---|
![]() | www.advintpharma.in | |||
![]() | 9773685656 | |||
![]() | sales@advintpharma.com | |||
| Chemical distributor since 2021 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Pure Research Chemicals | China | |||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Shanghai Worldyang Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | Trityl olmesartan ethyl ester |
| Synonyms | 4-(1-Hydroxy-1-methylethyl)-2-propyl-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylic acid ethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C45H44N6O3 |
| Molecular Weight | 716.87 |
| CAS Registry Number | 144690-33-5 |
| EC Number | 604-436-8 |
| SMILES | CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN=NN4C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)C(=O)OCC)C(C)(C)O |
| Solubility | Insoluble (4.5E-6 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.18±0.1 g/cm3 (20 °C 760 Torr), Calc.* |
| Melting point | 161 °C** |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2014 ACD/Labs) |
| ** | Pati, Hari Narayan |
| Hazard Symbols | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H228 Details | ||||||||
| Safety Statements | P240-P210-P241-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details | ||||||||
| Hazard Classification | |||||||||
| |||||||||
| SDS | Available | ||||||||
|
Trityl olmesartan ethyl ester is a chemical compound notable for its role in pharmaceutical research and development. With the formula C32H35ClN6O4, it is a derivative of olmesartan, an angiotensin II receptor blocker used primarily for the treatment of hypertension. The trityl group, a large protective group, is introduced in this compound to enhance its stability and facilitate various chemical manipulations. The discovery of trityl olmesartan ethyl ester builds on the foundation of olmesartan's established pharmacological properties. Olmesartan itself is a widely used antihypertensive drug, effective in managing high blood pressure by blocking the action of angiotensin II, a peptide that causes blood vessels to constrict. The addition of the trityl group to olmesartan creates a new derivative that serves as a valuable intermediate in the synthesis of other pharmaceutical agents or as a tool in research. The synthesis of trityl olmesartan ethyl ester involves the attachment of a trityl group to the olmesartan molecule. This process typically requires the use of a tritylation reagent, which reacts with the olmesartan ethyl ester to form the protected derivative. The reaction conditions must be carefully controlled to ensure that the trityl group is introduced without affecting the integrity of the olmesartan structure. Purification methods such as chromatography are employed to isolate the desired product, and its structure is confirmed using techniques like nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. Trityl olmesartan ethyl ester is primarily used as an intermediate in the synthesis of complex pharmaceutical compounds. The presence of the trityl group makes it easier to handle and purify during the chemical synthesis process. The compound is utilized in the development of novel drug formulations where precise control over the chemical structure is required. By protecting certain functional groups, trityl olmesartan ethyl ester allows chemists to selectively modify other parts of the molecule, leading to the creation of new derivatives with potentially enhanced properties. One of the key applications of trityl olmesartan ethyl ester is in the synthesis of olmesartan prodrugs. Prodrugs are compounds that undergo metabolic conversion within the body to release the active drug. The trityl group in trityl olmesartan ethyl ester can be used to modify the olmesartan molecule to create prodrugs with improved pharmacokinetic properties, such as better absorption or longer duration of action. In addition to its use in drug synthesis, trityl olmesartan ethyl ester is valuable in research settings. Scientists use this compound to study the behavior of olmesartan derivatives and to explore their interactions with biological targets. The trityl group’s role as a protective group allows for controlled experimentation and the development of new chemical entities based on the olmesartan structure. The development and use of trityl olmesartan ethyl ester highlight the importance of chemical modifications in pharmaceutical research. By introducing protective groups like trityl, researchers can gain greater control over the synthesis and properties of complex molecules, leading to advancements in drug development and therapeutic options. Overall, trityl olmesartan ethyl ester is a significant compound in the field of medicinal chemistry, offering valuable applications in drug synthesis and research. Its role in the development of olmesartan-based drugs and its utility in chemical research underscore its importance in advancing pharmaceutical science. References 2006. Olmesartan medoxomil. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-15-0008 |
| Market Analysis Reports |