|
CAS#: 1450-18-6 Product: 1,1,1-Trimethyl-2,2,2-Triphenyldisilane No suppilers available for the product. |
| Name | 1,1,1-Trimethyl-2,2,2-Triphenyldisilane |
|---|---|
| Synonyms | Tri(Phenyl)-Trimethylsilyl-Silane; 1,1,1-Trimethyl-2,2,2-Triphenyldisilane; Disilane, 1,1,1-Trimethyl-2,2,2-Triphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24Si2 |
| Molecular Weight | 332.59 |
| CAS Registry Number | 1450-18-6 |
| EINECS | 215-912-6 |
| SMILES | C3=C([Si]([Si](C)(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C21H24Si2/c1-22(2,3)23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3 |
| InChIKey | BSFLZHNGSJZLQC-UHFFFAOYSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.659°C at 760 mmHg (Cal.) |
| Flash point | 165.77°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trimethyl-2,2,2-Triphenyldisilane |