Online Database of Chemicals from Around the World
|
CAS#: 14595-77-8 Product: Trimethyl-(phenyl-trimethylsilyl-methyl)silane No suppilers available for the product. |
| Name | Trimethyl-(phenyl-trimethylsilyl-methyl)silane |
|---|---|
| Synonyms | Trimethyl-(Phenyl-Trimethylsilyl-Methyl)Silane; Silane, (Phenylmethylene)Bis(Trimethyl-; Silane,(Phenylmethylene)Bis[Trimethyl |
| Molecular Structure |  |
| Molecular Formula | C13H24Si2 |
| Molecular Weight | 236.50 |
| CAS Registry Number | 14595-77-8 |
| SMILES | C1=C(C([Si](C)(C)C)[Si](C)(C)C)C=CC=C1 |
| InChI | 1S/C13H24Si2/c1-14(2,3)13(15(4,5)6)12-10-8-7-9-11-12/h7-11,13H,1-6H3 |
| InChIKey | NISUIYZIODIZTR-UHFFFAOYSA-N |
| Density | 0.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.042°C at 760 mmHg (Cal.) |
| Flash point | 85.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl-(phenyl-trimethylsilyl-methyl)silane |