Online Database of Chemicals from Around the World
(4S)-4,7,7-trimethyl-4-phenyl-3-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one
[CAS# 1597438-92-0]
Identification| Name | (4S)-4,7,7-trimethyl-4-phenyl-3-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|
|
| Molecular Structure | ![CAS # 1597438-92-0, (4S)-4,7,7-trimethyl-4-phenyl-3-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one](/structures/1597438-92-0.gif) |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 |
| CAS Registry Number | 1597438-92-0 |
| SMILES | C[C@]1(C2=C(CC(CC2=O)(C)C)NC3=NNC(=C31)C(F)(F)F)C4=CC=CC=C4 |
|
Properties
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.612, Calc.* |
| Boiling Point | 431.2±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 214.6±31.5 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
1,3,3-Trimethyl... 4-(2,4,6-Trimet... N-[4-(2,4,6-Tri... 2-[(2,4,6-Trime... Trimethyl(pheny... Trimethyl[(phen... N-(2,4,5-Trimet... N-(2,4,6-Trimet... Trimethyl(pheny... 5,N,N-Trimethyl... 1,1,3-Trimethyl... 1,1,3-Trimethyl... 1,3,3-Trimethyl... 1,3,3-Trimethyl... Trimethyl-(phen... Trimethylphloro... Trimethyl phosp... Trimethylphosph... Trimethylphosph... Trimethylphosph...