Online Database of Chemicals from Around the World
| Name | Bis(Tribromomethyl) Sulfoxide |
|---|---|
| Synonyms | 4-03-00-00291 (Beilstein Handbook Reference); Brn 1777907; Bis-Tribromomethyl Sulfoxide |
| Molecular Structure |  |
| Molecular Formula | C2Br6OS |
| Molecular Weight | 551.51 |
| CAS Registry Number | 14604-61-6 |
| SMILES | O=[S](C(Br)(Br)Br)C(Br)(Br)Br |
| InChI | 1S/C2Br6OS/c3-1(4,5)10(9)2(6,7)8 |
| InChIKey | IMXXWWGWTMVZBZ-UHFFFAOYSA-N |
| Density | 3.671g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.677°C at 760 mmHg (Cal.) |
| Flash point | 190.075°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Tribromomethyl) Sulfoxide |
