Online Database of Chemicals from Around the World
| Name | 1,3-Bis(Tribromophenoxy)Propan-2-Ol |
|---|---|
| Synonyms | 1,3-Bis(Tribromophenoxy)Propan-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C15H10Br6O3 |
| Molecular Weight | 717.67 |
| CAS Registry Number | 55067-98-6 |
| EINECS | 259-471-8 |
| SMILES | C1=CC(=C(Br)C(=C1Br)Br)OCC(O)COC2=CC=C(Br)C(=C2Br)Br |
| InChI | 1S/C15H10Br6O3/c16-8-1-3-10(14(20)12(8)18)23-5-7(22)6-24-11-4-2-9(17)13(19)15(11)21/h1-4,7,22H,5-6H2 |
| InChIKey | RCWABTBIRDAWRL-UHFFFAOYSA-N |
| Density | 2.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 627.074°C at 760 mmHg (Cal.) |
| Flash point | 333.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(Tribromophenoxy)Propan-2-Ol |
