Online Database of Chemicals from Around the World
|
CAS#: 1463-77-0 Product: Copper(II) Cyanide No suppilers available for the product. |
| Name | Copper(II) Cyanide |
|---|---|
| Synonyms | 2,6-Dichloro-4-Pyridinecarboxylic Acid 2-Chloroethyl Ester; 2,6-Dichloroisonicotinic Acid 2-Chloroethyl Ester; 2-Chloroethyl 2,6-Dichloroisonicotinate |
| Molecular Structure |  |
| Molecular Formula | C8H6Cl3NO2 |
| Molecular Weight | 254.50 |
| CAS Registry Number | 1463-77-0 |
| SMILES | C1=C(N=C(C=C1C(=O)OCCCl)Cl)Cl |
| InChI | 1S/C8H6Cl3NO2/c9-1-2-14-8(13)5-3-6(10)12-7(11)4-5/h3-4H,1-2H2 |
| InChIKey | OAHOEVKBVUJZSP-UHFFFAOYSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.294°C at 760 mmHg (Cal.) |
| Flash point | 176.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Copper(II) Cyanide |