Online Database of Chemicals from Around the World
| Name | Phenanthro[2,1-d]Thiazole |
|---|---|
| Synonyms | Brn 1110044; Phenanthro(2,1-D)Thiazole |
| Molecular Structure | ![CAS#: 14635-33-7， Phenanthro[2,1-d]Thiazole](/moreStructures/14635-33-7.gif) |
| Molecular Formula | C15H9NS |
| Molecular Weight | 235.30 |
| CAS Registry Number | 14635-33-7 |
| SMILES | C2=NC1=CC=C3C(=C1S2)C=CC4=C3C=CC=C4 |
| InChI | 1S/C15H9NS/c1-2-4-11-10(3-1)5-6-13-12(11)7-8-14-15(13)17-9-16-14/h1-9H |
| InChIKey | OUXFGDZJCPQYRY-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.72°C at 760 mmHg (Cal.) |
| Flash point | 236.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthro[2,1-d]Thiazole |
