| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 |
| CAS Registry Number | 146651-71-0 |
| SMILES | CC(C)(C)OC(=O)NC(CO)(CO)CO |
| Solubility | 1.556e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.501, Calc.* |
| Melting point | 123.28 °C |
| Boiling Point | 361.82 °C, 430.5±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 214.2±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate |