| Sinocure Chemical Group | China | Inquire | ||
|---|---|---|---|---|
![]() | www.sinocurechem.com | |||
![]() | +86 15550440621 | |||
![]() | info@sinocurechem.com | |||
| Chemical manufacturer since 2020 | ||||
| Classification | Chemical reagent >> Organic reagent >> Ether |
|---|---|
| Name | Pentaerythritol triallyl ether |
| Synonyms | 3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 |
| CAS Registry Number | 1471-17-6 |
| EC Number | 216-008-4 |
| SMILES | C=CCOCC(CO)(COCC=C)COCC=C |
| Solubility | 0.0022 g/l (water 20 °C) |
|---|---|
| Density | 1.04-1.07 g/cm3 (20 °C) |
| Melting Point | <-15 °C |
| Flash point | 210 - 240 °C |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H412 Details | ||||||||||||||||
| Safety Statements | P264-P264+P265-P273-P280-P302+P352-P305+P351+P338-P321-P332+P317-P337+P317-P362+P364-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
|
Pentaerythritol triallyl ether is a chemical compound widely used in various industrial applications due to its unique chemical properties. This substance is derived from the reaction of pentaerythritol with allyl alcohol, resulting in a compound with three allyl groups attached to a pentaerythritol backbone. Its chemical structure, featuring multiple reactive allyl groups, makes it highly valuable in the field of polymer chemistry and resin technology. The discovery of pentaerythritol triallyl ether can be traced back to research on multifunctional monomers for the synthesis of crosslinked polymers. The compound was identified as a promising candidate due to its ability to form highly crosslinked networks upon polymerization. The process involves the reaction of pentaerythritol, a four-hydroxyl alcohol, with allyl alcohol, resulting in the formation of the ether compound. This reaction creates a compound with three allyl groups, which are highly reactive and capable of participating in polymerization reactions. One of the primary applications of pentaerythritol triallyl ether is in the production of crosslinked polymers and resins. The compound's multiple allyl groups enable it to act as a crosslinking agent, which enhances the mechanical properties and thermal stability of the resulting polymers. These properties are particularly useful in the production of high-performance materials such as coatings, adhesives, and composite materials. The crosslinked networks formed with pentaerythritol triallyl ether contribute to improved durability and resistance to environmental factors. In addition to its use in polymer chemistry, pentaerythritol triallyl ether is employed in the formulation of UV-curable coatings and inks. The compound's ability to undergo rapid polymerization upon exposure to UV light makes it an ideal candidate for UV-curable systems. These systems are widely used in various industries, including automotive, electronics, and printing, due to their fast curing times and high-performance characteristics. Pentaerythritol triallyl ether's role in these applications is crucial for achieving the desired properties of the final products. Another notable application of pentaerythritol triallyl ether is in the production of dental materials. The compound is used as a crosslinking agent in the formulation of dental resins and composites. Its presence improves the mechanical strength and wear resistance of dental materials, making them more durable and effective for use in restorative dentistry. Despite its advantages, there are considerations related to the handling and safety of pentaerythritol triallyl ether. As with many chemical compounds used in polymerization processes, it is important to follow appropriate safety protocols and guidelines to minimize exposure and ensure safe use. Overall, pentaerythritol triallyl ether is a significant chemical compound with diverse applications in polymer chemistry, UV-curable systems, and dental materials. Its unique properties make it a valuable component in the development of high-performance materials and products. References 2021. Evaluation of a Superabsorbent Polymer for Plugging Karst Pipe Type Water Inrushes. Mine Water and the Environment, 40, 3. DOI: 10.1007/s10230-021-00802-1 2018. Poly(lactic acid) based hydrogels: formation, characteristics and biomedical applications. Journal of Porous Materials, 26, 1. DOI: 10.1007/s10934-018-0687-z 2017. Poly(epsilon-caprolactone) networks with tunable thermoresponsive shape memory via a facile photo-initiated thiol-ene pathway. Journal of Materials Science, 53, 1. DOI: 10.1007/s10853-017-1643-z |
| Market Analysis Reports |
| List of Reports Available for Pentaerythritol triallyl ether |