|
CAS#: 14798-26-6 Product: 2,4,6-Trinitrophenolate No suppilers available for the product. |
| Name | 2,4,6-Trinitrophenolate |
|---|---|
| Synonyms | Lyddite; Melinite; Pertite |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2N3O7 |
| Molecular Weight | 228.10 |
| CAS Registry Number | 14798-26-6 |
| SMILES | c1c(cc(c(c1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H/p-1 |
| InChIKey | OXNIZHLAWKMVMX-UHFFFAOYSA-M |
| Boiling point | 303.56°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.896°C (Cal.) |
| Refractive index | (Cal.) |
| (1) | Chantal Valeriani, Philip J. Camp, Jos W. Zwanikken, René van Roij and Marjolein Dijkstra. Ion association in low-polarity solvents: comparisons between theory, simulation, and experiment, Soft Matter, 2010, 6, 2793. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trinitrophenolate |