Online Database of Chemicals from Around the World
|
CAS#: 47430-58-0 Product: 2,4,7-Trinitrophenanthrenequinone No suppilers available for the product. |
| Name | 2,4,7-Trinitrophenanthrenequinone |
|---|---|
| Synonyms | 2,4,7-Trinitrophenanthrene-9,10-Quinone; 2,4,7-Trinitrophenanthrenequinone; 2-07-00-00730 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C14H5N3O8 |
| Molecular Weight | 343.21 |
| CAS Registry Number | 47430-58-0 |
| SMILES | C1=C2C(=C([N+]([O-])=O)C=C1[N+]([O-])=O)C3=C(C(=O)C2=O)C=C([N+]([O-])=O)C=C3 |
| InChI | 1S/C14H5N3O8/c18-13-9-3-6(15(20)21)1-2-8(9)12-10(14(13)19)4-7(16(22)23)5-11(12)17(24)25/h1-5H |
| InChIKey | RBFUXCYPJKXNMP-UHFFFAOYSA-N |
| Density | 1.764g/cm3 (Cal.) |
|---|---|
| Boiling point | 610.717°C at 760 mmHg (Cal.) |
| Flash point | 315.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,7-Trinitrophenanthrenequinone |