|
CAS#: 148367-85-5 Product: Ethyl (5Z)-5-(Cyanoimino)-4-(3,5-Dichlorophenyl)-4,5-Dihydro-1,3,4-Thiadiazole-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl (5Z)-5-(Cyanoimino)-4-(3,5-Dichlorophenyl)-4,5-Dihydro-1,3,4-Thiadiazole-2-Carboxylate |
|---|---|
| Synonyms | dihydro-1,3,4-thiadiazole-2-carboxylate; Ethyl 5-cyanamide-4-(3,5-dichlorophenyl)-4,5-; Ethyl 5-c |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2N4O2S |
| Molecular Weight | 343.19 |
| CAS Registry Number | 148367-85-5 |
| SMILES | N#C\N=C2/S\C(=N/N2c1cc(Cl)cc(Cl)c1)C(=O)OCC |
| InChI | 1S/C12H8Cl2N4O2S/c1-2-20-11(19)10-17-18(12(21-10)16-6-15)9-4-7(13)3-8(14)5-9/h3-5H,2H2,1H3/b16-12- |
| InChIKey | JIJFDKNDYYTTKA-VBKFSLOCSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.675°C at 760 mmHg (Cal.) |
| Flash point | 234.827°C (Cal.) |
| Refractive index | 1.68 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (5Z)-5-(Cyanoimino)-4-(3,5-Dichlorophenyl)-4,5-Dihydro-1,3,4-Thiadiazole-2-Carboxylate |