Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 451-7400 | |||
|
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl (2Z)-2-Cyano-3-[2-(2-Hydroxyethoxy)Phenyl]Acrylate |
|---|---|
| Synonyms | ethyl 2-cyano-3-[2-(2-hydroxyethoxy)phenyl]acrylate; ZINC05005505 |
| Molecular Structure | ![CAS#: 418785-96-3， Ethyl (2Z)-2-Cyano-3-[2-(2-Hydroxyethoxy)Phenyl]Acrylate](/moreStructures/418785-96-3.gif) |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.27 |
| CAS Registry Number | 418785-96-3 |
| SMILES | N#C/C(C(=O)OCC)=C/c1ccccc1OCCO |
| InChI | 1S/C14H15NO4/c1-2-18-14(17)12(10-15)9-11-5-3-4-6-13(11)19-8-7-16/h3-6,9,16H,2,7-8H2,1H3/b12-9- |
| InChIKey | PNURBIGWTNEECP-XFXZXTDPSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.14°C at 760 mmHg (Cal.) |
| Flash point | 221.803°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2Z)-2-Cyano-3-[2-(2-Hydroxyethoxy)Phenyl]Acrylate |