|
CAS#: 148367-89-9 Product: Ethyl (5Z)-4-(3-Chloro-4-Methylphenyl)-5-(Cyanoimino)-4,5-Dihydro-1,3,4-Thiadiazole-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl (5Z)-4-(3-Chloro-4-Methylphenyl)-5-(Cyanoimino)-4,5-Dihydro-1,3,4-Thiadiazole-2-Carboxylate |
|---|---|
| Synonyms | dihydro-1,3,4-thiadiazole-2-carboxylate; Ethyl 4-(3-chloro-4-methylphenyl)-5-cyanamide-4,5-; Ethyl 4-( |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.77 |
| CAS Registry Number | 148367-89-9 |
| SMILES | N#C\N=C2/S\C(=N/N2c1ccc(c(Cl)c1)C)C(=O)OCC |
| InChI | 1S/C13H11ClN4O2S/c1-3-20-12(19)11-17-18(13(21-11)16-7-15)9-5-4-8(2)10(14)6-9/h4-6H,3H2,1-2H3/b16-13- |
| InChIKey | MKDHDVFIEGYGOK-SSZFMOIBSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.88°C at 760 mmHg (Cal.) |
| Flash point | 226.484°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl (5Z)-4-(3-Chloro-4-Methylphenyl)-5-(Cyanoimino)-4,5-Dihydro-1,3,4-Thiadiazole-2-Carboxylate |