|
CAS#: 43153-03-3 Product: Ethyl 2-[4-(Chloromethyl)Phenyl]Propanoate No suppilers available for the product. |
| Name | Ethyl 2-[4-(Chloromethyl)Phenyl]Propanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 |
| CAS Registry Number | 43153-03-3 |
| SMILES | ClCc1ccc(cc1)C(C)C(=O)OCC |
| InChI | 1S/C12H15ClO2/c1-3-15-12(14)9(2)11-6-4-10(8-13)5-7-11/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | LJRSKOFNPMYRSO-UHFFFAOYSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.79°C at 760 mmHg (Cal.) |
| Flash point | 144.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-[4-(Chloromethyl)Phenyl]Propanoate |