Online Database of Chemicals from Around the World
| Name | Cyclopropylcarbonylphosphonic Acid Diethyl Ester |
|---|---|
| Synonyms | Cyclopropyl-Diethoxyphosphoryl-Methanone; (Cyclopropylcarbonyl)Phosphonic Acid Diethyl Ester; Nsc82844 |
| Molecular Structure |  |
| Molecular Formula | C8H15O4P |
| Molecular Weight | 206.18 |
| CAS Registry Number | 1489-91-4 |
| SMILES | C(O[P](C(C1CC1)=O)(=O)OCC)C |
| InChI | 1S/C8H15O4P/c1-3-11-13(10,12-4-2)8(9)7-5-6-7/h7H,3-6H2,1-2H3 |
| InChIKey | IOSOXYZYSATVMG-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.195°C at 760 mmHg (Cal.) |
| Flash point | 123.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclopropylcarbonylphosphonic Acid Diethyl Ester |
