Online Database of Chemicals from Around the World
| Name | Methyl(Diphenyl)(Trimethylstannyl)Silane |
|---|---|
| Synonyms | Trimethyl stannyl diphenyl methyl silane; Trimethylstannyldiphenylmethylsilane |
| Molecular Structure |  |
| Molecular Formula | C16H22SiSn |
| Molecular Weight | 361.14 |
| CAS Registry Number | 149013-84-3 |
| SMILES | C[Si](c1ccccc1)(c2ccccc2)[Sn](C)(C)C |
| InChI | 1S/C13H13Si.3CH3.Sn/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;;;;/h2-11H,1H3;3*1H3; |
| InChIKey | VRHBFHZSPDOAKI-UHFFFAOYSA-N |
| Boiling point | 624.6265-630.5041°C (Expl.) |
|---|---|
| 328.434°C at 760 mmHg (Cal.) | |
| Flash point | 152.432°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl(Diphenyl)(Trimethylstannyl)Silane |
