Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Methyl-3,5-Di(Propan-2-Yl)Benzene |
|---|---|
| Synonyms | 1,3-Diisopropyl-5-Methyl-Benzene; 1,3-Diisopropyl-5-Methylbenzene; St5443360 |
| Molecular Structure |  |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 |
| CAS Registry Number | 3055-14-9 |
| SMILES | C1=C(C=C(C=C1C)C(C)C)C(C)C |
| InChI | 1S/C13H20/c1-9(2)12-6-11(5)7-13(8-12)10(3)4/h6-10H,1-5H3 |
| InChIKey | SOALUUXENHDLMW-UHFFFAOYSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 217.741°C at 760 mmHg (Cal.) |
| Flash point | 77.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3,5-Di(Propan-2-Yl)Benzene |