| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Formoterol EP Impurity A |
|---|---|
| Synonyms | 2-amino-4-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.39 |
| CAS Registry Number | 150513-24-9 |
| SMILES | CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)N)O |
| Solubility | 7143 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.613, Calc.* |
| Melting point | 201.92 °C |
| Boiling Point | 477.14 °C, 545.7±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 283.8±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Formoterol EP Impurity A |