| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Antiparasitic drug >> Anti-amebiasis and anti-trichomoniasis drugs |
|---|---|
| Name | Forminitrazole |
| Synonyms | N-(5-Nitrothiazol-2-Yl)Formamide; N-(5-Nitro-2-Thiazolyl)Formamide; N-(5-Nitro-1,3-Thiazol-2-Yl)Methanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C4H3N3O3S |
| Molecular Weight | 173.15 |
| CAS Registry Number | 500-08-3 |
| SMILES | C1=C(SC(=N1)NC=O)[N+](=O)[O-] |
| InChI | 1S/C4H3N3O3S/c8-2-6-4-5-1-3(11-4)7(9)10/h1-2H,(H,5,6,8) |
| InChIKey | ODLJCVGAFRZOOB-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Forminitrazole |