| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic palladium |
|---|---|
| Name | 4MetBuXPhos Pd G3 |
| Synonyms | Methanesulfonato(2-di-t-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-tri-i-propylbiphenyl)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) |
| Molecular Structure | ![]() |
| Molecular Formula | C46H66NO3PPdS |
| Molecular Weight | 850.48 |
| CAS Registry Number | 1507403-85-1 |
| EC Number | 813-049-5 |
| SMILES | Cc1c(c(c(c(c1C)c2c(cc(cc2C(C)C)C(C)C)C(C)C)P(C(C)(C)C)C(C)(C)C)C)C.CS(=O)(=O)O[Pd]c1ccccc1c2ccccc2N |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
|
4MetBuXPhos Pd G3 is a highly specialized palladium complex that stands out for its role in catalysis, particularly in cross-coupling reactions. The compound features a palladium(II) center coordinated by the 4MetBuXPhos ligand, which is known for its exceptional properties in enhancing the performance of catalytic processes. The ligand 4MetBuXPhos, short for 4-methylbutyl-2-diphenylphosphino-2',6'-dimethylphenylphosphine, plays a crucial role in the functionality of the complex. This ligand is designed to balance steric and electronic effects around the palladium center, which significantly influences the complex's catalytic activity. The "G3" designation indicates that this is the third generation of the 4MetBuXPhos ligand, reflecting its advanced development for improved performance. The 4MetBuXPhos ligand includes both bulky and electron-donating groups, which provide several advantages. The 4-methylbutyl substituent increases the steric bulk around the phosphine group, reducing potential steric hindrance and facilitating better substrate accessibility. This bulkiness helps in achieving high activity and selectivity in catalytic reactions by preventing catalyst deactivation due to steric congestion. The diphenylphosphine and dimethylphenylphosphine groups further contribute to the ligand's electronic properties, stabilizing the palladium center and enhancing its reactivity. One of the key applications of 4MetBuXPhos Pd G3 is in cross-coupling reactions, such as the Suzuki-Miyaura, Heck, and Negishi couplings. These reactions are fundamental in organic synthesis, allowing for the formation of carbon-carbon bonds to create complex molecules, including pharmaceuticals and advanced materials. The effectiveness of 4MetBuXPhos Pd G3 in these reactions is attributed to its optimized ligand environment, which promotes high efficiency and selectivity. In addition to cross-coupling reactions, 4MetBuXPhos Pd G3 can be used in other types of catalytic transformations. Its ability to stabilize different oxidation states of palladium makes it suitable for a variety of oxidative and reductive processes. The ligand's design ensures that the palladium center remains active and effective across a range of chemical reactions. The development of 4MetBuXPhos Pd G3 highlights the importance of advanced ligand design in catalysis. By fine-tuning the steric and electronic properties of the ligand, researchers can achieve better catalytic performance, making this complex a valuable tool in both academic research and industrial applications. In summary, 4MetBuXPhos Pd G3 is an advanced palladium complex with significant applications in organic synthesis. Its specialized ligand system enhances catalytic efficiency and selectivity, making it a powerful tool for a wide range of chemical reactions. |
| Market Analysis Reports |