Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Ethoxy-3-Biphenylol |
|---|---|
| Synonyms | [1,1-Biphenyl]-3-ol,5-ethoxy-; 5-ethoxy-[1,1'-biphenyl]-3-ol |
| Molecular Structure |  |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 150969-53-2 |
| SMILES | O(c1cc(cc(O)c1)c2ccccc2)CC |
| InChI | 1S/C14H14O2/c1-2-16-14-9-12(8-13(15)10-14)11-6-4-3-5-7-11/h3-10,15H,2H2,1H3 |
| InChIKey | RKEFBIHEBWESGD-UHFFFAOYSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.166°C at 760 mmHg (Cal.) |
| Flash point | 229.298°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethoxy-3-Biphenylol |