Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Ethoxy-2,5-Biphenyldiol |
|---|---|
| Synonyms | [1,1-Biphenyl]-2,5-diol,4-ethoxy-; 4-ethoxy-[1,1'-biphenyl]-2,5-diol |
| Molecular Structure |  |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 191666-62-3 |
| SMILES | CCOc1cc(c(cc1O)c2ccccc2)O |
| InChI | 1S/C14H14O3/c1-2-17-14-9-12(15)11(8-13(14)16)10-6-4-3-5-7-10/h3-9,15-16H,2H2,1H3 |
| InChIKey | RKKBQMYKXJNBIK-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.849°C at 760 mmHg (Cal.) |
| Flash point | 208.927°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-2,5-Biphenyldiol |