Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Methoxy-4-[(Trifluoromethyl)Sulfonyl]Benzene |
|---|---|
| Synonyms | 1-Methoxy-4-[(trifluoromethyl)sulfonyl]benzene #; 1-Methoxy-4-trifluoromethanesulfonyl-benzene |
| Molecular Structure | ![CAS#: 15183-74-1， 1-Methoxy-4-[(Trifluoromethyl)Sulfonyl]Benzene](/moreStructures/15183-74-1.gif) |
| Molecular Formula | C8H7F3O3S |
| Molecular Weight | 240.20 |
| CAS Registry Number | 15183-74-1 |
| SMILES | FC(F)(F)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | 1S/C8H7F3O3S/c1-14-6-2-4-7(5-3-6)15(12,13)8(9,10)11/h2-5H,1H3 |
| InChIKey | YZMRPUPSJOQDBS-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.903°C at 760 mmHg (Cal.) |
| Flash point | 127.315°C (Cal.) |
| Refractive index | 1.459 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-[(Trifluoromethyl)Sulfonyl]Benzene |