|
CAS#: 66922-70-1 Product: 3'-Methoxy-alpha,alpha,4'-Trihydroxyacetophenone No suppilers available for the product. |
| Name | 3'-Methoxy-alpha,alpha,4'-Trihydroxyacetophenone |
|---|---|
| Synonyms | 2,2-Dihydroxy-1-(4-Hydroxy-3-Methoxy-Phenyl)Ethanone; 3'-Methoxy-2,2,4'-Trihydroxyacetophenone; Acetophenone, 3'-Methoxy-2,2,4'-Trihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.18 |
| CAS Registry Number | 66922-70-1 |
| SMILES | C1=C(C(=CC=C1C(C(O)O)=O)O)OC |
| InChI | 1S/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,9-10,12-13H,1H3 |
| InChIKey | SGFVYAYEGJHREZ-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.878°C at 760 mmHg (Cal.) |
| Flash point | 158.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3'-Methoxy-alpha,alpha,4'-Trihydroxyacetophenone |