Online Database of Chemicals from Around the World
|
CAS#: 15222-54-5 Product: 1,3,6-Trimethoxy-8-Methyl-9H-Xanthen-9-One No suppilers available for the product. |
| Name | 1,3,6-Trimethoxy-8-Methyl-9H-Xanthen-9-One |
|---|---|
| Synonyms | 1,3,6-trimethoxy-8-methyl-9H-xanthen-9-one; 1,3,6-Trimethoxy-8-methyl-9H-xanthen-9-one # |
| Molecular Structure |  |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 |
| CAS Registry Number | 15222-54-5 |
| SMILES | O=C1c3c(Oc2c1c(OC)cc(OC)c2)cc(OC)cc3C |
| InChI | 1S/C17H16O5/c1-9-5-10(19-2)7-13-15(9)17(18)16-12(21-4)6-11(20-3)8-14(16)22-13/h5-8H,1-4H3 |
| InChIKey | FXRINAYZWOCAFQ-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.533°C at 760 mmHg (Cal.) |
| Flash point | 209.225°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,6-Trimethoxy-8-Methyl-9H-Xanthen-9-One |