Online Database of Chemicals from Around the World
|
CAS#: 69791-81-7 Product: 5,6,7-Trimethoxy-2-Naphthoic Acid No suppilers available for the product. |
| Name | 5,6,7-Trimethoxy-2-Naphthoic Acid |
|---|---|
| Synonyms | 5,6,7-Trimethoxy-2-Naphthalenecarboxylic Acid; 5,6,7-Trimethoxy-2-Naphthoic Acid |
| Molecular Structure |  |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 |
| CAS Registry Number | 69791-81-7 |
| EINECS | 274-118-8 |
| SMILES | C1=C(OC)C(=C(OC)C2=C1C=C(C(=O)O)C=C2)OC |
| InChI | 1S/C14H14O5/c1-17-11-7-9-6-8(14(15)16)4-5-10(9)12(18-2)13(11)19-3/h4-7H,1-3H3,(H,15,16) |
| InChIKey | UDAHTEIDHNWRAS-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.775°C at 760 mmHg (Cal.) |
| Flash point | 156.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7-Trimethoxy-2-Naphthoic Acid |