Online Database of Chemicals from Around the World
| Name | 1,9-Dimethylanthracene |
|---|---|
| Synonyms | 5,10-Dimethylanthracene; Anthracene, 1,9-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 1523-23-5 |
| SMILES | C1=C3C(=C(C2=C1C=CC=C2)C)C(=CC=C3)C |
| InChI | 1S/C16H14/c1-11-6-5-8-14-10-13-7-3-4-9-15(13)12(2)16(11)14/h3-10H,1-2H3 |
| InChIKey | CKZCNFPQIPSSAW-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.61°C at 760 mmHg (Cal.) |
| Flash point | 171.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,9-Dimethylanthracene |
