Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6,12-Dimethylanthanthrene |
|---|---|
| Synonyms | Brn 1884677; Bibenzo(Def,Mno)Chrysene, 6,12-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C24H16 |
| Molecular Weight | 304.39 |
| CAS Registry Number | 41217-05-4 |
| SMILES | C4=CC2=CC=CC3=C(C1=CC=C6C5=C1C(=C23)C4=C(C)C5=CC=C6)C |
| InChI | 1S/C24H16/c1-13-17-7-3-5-15-10-12-20-14(2)18-8-4-6-16-9-11-19(13)23(22(16)18)24(20)21(15)17/h3-12H,1-2H3 |
| InChIKey | OJWXYTCJBBNRNX-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.599°C at 760 mmHg (Cal.) |
| Flash point | 262.761°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,12-Dimethylanthanthrene |