Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,6-Dimethylphenyl Methyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | (2,6-Dimethylphenyl) methyl; (2,6-Dimethylphenyl) methylcyanocarbonimidodithioate; cyanocarbonimidodithioate |
| Molecular Structure |  |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.36 |
| CAS Registry Number | 152382-30-4 |
| SMILES | N#C\N=C(/SC)Sc1c(cccc1C)C |
| InChI | 1S/C11H12N2S2/c1-8-5-4-6-9(2)10(8)15-11(14-3)13-7-12/h4-6H,1-3H3/b13-11+ |
| InChIKey | RHEHLHMJKOWAAM-ACCUITESSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.295°C at 760 mmHg (Cal.) |
| Flash point | 163.838°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethylphenyl Methyl Cyanocarbonodithioimidate |