Online Database of Chemicals from Around the World
|
CAS#: 152697-36-4 Product: Cycleabarbatine No suppilers available for the product. |
| Name | Cycleabarbatine |
|---|---|
| Synonyms | Cycleabarbatine |
| Molecular Structure |  |
| Molecular Formula | C37H40N2O6 |
| Molecular Weight | 608.73 |
| CAS Registry Number | 152697-36-4 |
| SMILES | [C@H]16N(CCC2=CC(=C(OC)C(=C12)OC3=C(OC)C=C4C(=C3)[C@@H](N(CC4)C)CC7=CC=C(OC5=CC(=CC=C5OC)C6)C=C7)O)C |
| InChI | 1S/C37H40N2O6/c1-38-14-12-24-20-32(42-4)34-21-27(24)28(38)16-22-6-9-26(10-7-22)44-33-18-23(8-11-31(33)41-3)17-29-35-25(13-15-39(29)2)19-30(40)36(43-5)37(35)45-34/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29+/m0/s1 |
| InChIKey | JIGFMOPXEDLMPQ-URLMMPGGSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 724.303°C at 760 mmHg (Cal.) |
| Flash point | 391.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cycleabarbatine |