Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N'-(2,5-Dichlorophenyl)-N,N-Dimethyl-Urea |
|---|---|
| Synonyms | 3-(2,5-Dichlorophenyl)-1,1-Dimethyl-Urea; Nsc190750 |
| Molecular Structure |  |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 |
| CAS Registry Number | 15441-87-9 |
| EINECS | 239-453-6 |
| SMILES | C1=C(Cl)C=CC(=C1NC(N(C)C)=O)Cl |
| InChI | 1S/C9H10Cl2N2O/c1-13(2)9(14)12-8-5-6(10)3-4-7(8)11/h3-5H,1-2H3,(H,12,14) |
| InChIKey | DOVGZPJULHERQI-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.017°C at 760 mmHg (Cal.) |
| Flash point | 180.604°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N'-(2,5-Dichlorophenyl)-N,N-Dimethyl-Urea |