| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(3,5-Dichlorophenyl)-2,5-Dimethyl-1H-Pyrrole |
|---|---|
| Synonyms | 1-(3,5-Dichlorophenyl)-2,5-dimethyl-1H-pyrrole; 1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.13 |
| CAS Registry Number | 175205-50-2 |
| SMILES | CC1=CC=C(N1C2=CC(=CC(=C2)Cl)Cl)C |
| InChI | 1S/C12H11Cl2N/c1-8-3-4-9(2)15(8)12-6-10(13)5-11(14)7-12/h3-7H,1-2H3 |
| InChIKey | PZQGRGDARNXLSP-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 78-80°C (Expl.) |
| Boiling point | 349.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 165.3±27.9°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-(3,5-Dichlorophenyl)-2,5-Dimethyl-1H-Pyrrole |