| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 4-[(R)-[(2S,5R)-4-Allyl-2,5-Dimethyl-1-Piperazinyl](3-Hydroxyphenyl)Methyl]-N,N-Diethylbenzamide |
|---|---|
| Synonyms | (±)-4-((α |
| Molecular Structure | ![]() |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.60 |
| CAS Registry Number | 155836-52-5 |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)[C@H](C2=CC(=CC=C2)O)N3C[C@H](N(C[C@@H]3C)CC=C)C |
| InChI | 1S/C27H37N3O2/c1-6-16-29-18-21(5)30(19-20(29)4)26(24-10-9-11-25(31)17-24)22-12-14-23(15-13-22)27(32)28(7-2)8-3/h6,9-15,17,20-21,26,31H,1,7-8,16,18-19H2,2-5H3/t20-,21+,26-/m1/s1 |
| InChIKey | LBLDMHBSVIVJPM-YZIHRLCOSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.5±50.0°C at 760 mmHg (Cal.) |
| Flash point | 304.3±30.1°C (Cal.) |
| Refractive index | 1.562 (Cal.) |
| solubility | Soluble to 100 mM in 1eq. HCl |
| Market Analysis Reports |
| List of Reports Available for 4-[(R)-[(2S,5R)-4-Allyl-2,5-Dimethyl-1-Piperazinyl](3-Hydroxyphenyl)Methyl]-N,N-Diethylbenzamide |