|
CAS#: 155836-78-5 Product: (2R,5S)-1-Allyl-2,5-Dimethylpiperazine No suppilers available for the product. |
| Name | (2R,5S)-1-Allyl-2,5-Dimethylpiperazine |
|---|---|
| Synonyms | (-)-(2R,5S)-1-Allyl-2,5-dimethylpiperazine; MFCD09753425; Piperazine,2,5-dimethyl-1-(2-propen-1-yl)-, (2R,5S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.25 |
| CAS Registry Number | 155836-78-5 |
| SMILES | C=C\CN1[C@@H](CN[C@H](C1)C)C |
| InChI | 1S/C9H18N2/c1-4-5-11-7-8(2)10-6-9(11)3/h4,8-10H,1,5-7H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | VKUXNUOPPQWDMV-DTWKUNHWSA-N |
| Density | 0.844g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.219°C at 760 mmHg (Cal.) |
| Flash point | 67.175°C (Cal.) |
| Refractive index | 1.443 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,5S)-1-Allyl-2,5-Dimethylpiperazine |