Online Database of Chemicals from Around the World
|
CAS#: 15596-57-3 Product: 4,4'-Dihydroxyazoxybenzene No suppilers available for the product. |
| Name | 4,4'-Dihydroxyazoxybenzene |
|---|---|
| Synonyms | 4-[Hydroxy-(4-Hydroxyphenyl)Hydrazono]Cyclohexa-2,5-Dien-1-One; 4-[Hydroxy-(4-Hydroxyphenyl)Hydrazono]-1-Cyclohexa-2,5-Dienone; Nsc85549 |
| Molecular Structure |  |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 |
| CAS Registry Number | 15596-57-3 |
| SMILES | C2=C(N(O)N=C1C=CC(=O)C=C1)C=CC(=C2)O |
| InChI | 1S/C12H10N2O3/c15-11-5-1-9(2-6-11)13-14(17)10-3-7-12(16)8-4-10/h1-8,16-17H |
| InChIKey | KMWVKNUDWACXKU-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.185°C at 760 mmHg (Cal.) |
| Flash point | 234.531°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dihydroxyazoxybenzene |