Online Database of Chemicals from Around the World
| Name | 3,3'-Dihydroxyazoxybenzene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 |
| CAS Registry Number | 17540-51-1 |
| SMILES | Oc2cccc(/N=[N+](/[O-])c1cccc(O)c1)c2 |
| InChI | 1S/C12H10N2O3/c15-11-5-1-3-9(7-11)13-14(17)10-4-2-6-12(16)8-10/h1-8,15-16H |
| InChIKey | FZZROTIREDKBGJ-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Melting point | 183°C (Expl.) |
| Boiling point | 496.291°C at 760 mmHg (Cal.) |
| Flash point | 253.948°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dihydroxyazoxybenzene |
