Online Database of Chemicals from Around the World
|
CAS#: 15640-40-1 Product: 4,4'-Methylenebis(2,6-Dimethoxyphenol) No suppilers available for the product. |
| Name | 4,4'-Methylenebis(2,6-Dimethoxyphenol) |
|---|---|
| Synonyms | 4-[(4-Hydroxy-3,5-Dimethoxy-Phenyl)Methyl]-2,6-Dimethoxy-Phenol; 4-(4-Hydroxy-3,5-Dimethoxy-Benzyl)-2,6-Dimethoxy-Phenol; 4,4'-Dihydroxy-3,5,3',5'-Tetramethoxydiphenylmethane |
| Molecular Structure |  |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 |
| CAS Registry Number | 15640-40-1 |
| SMILES | C2=C(CC1=CC(=C(C(=C1)OC)O)OC)C=C(C(=C2OC)O)OC |
| InChI | 1S/C17H20O6/c1-20-12-6-10(7-13(21-2)16(12)18)5-11-8-14(22-3)17(19)15(9-11)23-4/h6-9,18-19H,5H2,1-4H3 |
| InChIKey | NDYPCLQAPPEYLS-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.84°C at 760 mmHg (Cal.) |
| Flash point | 251.256°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Methylenebis(2,6-Dimethoxyphenol) |